C29H27N3O4 — CID 3555349
2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 3555349) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 3555349 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc(CN2CC(=O)N3C(Cc4c([nH]c5ccccc45)C3c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H27N3O4/c1-35-20-11-7-18(8-12-20)16-31-17-26(33)32-25(29(31)34)15-23-22-5-3-4-6-24(22)30-27(23)28(32)19-9-13-21(36-2)14-10-19/h3-14,25,28,30H,15-17H2,1-2H3 |
| InChIKey | ZETONVCQJKAJOK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|