C29H24ClN3O4 — CID 3830548
methyl 4-[6-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate (PubChem CID 3830548) has the molecular formula C29H24ClN3O4 and a molecular weight of 513.98 g/mol. Its IUPAC name is methyl 4-[6-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate.
| Compound Name | methyl 4-[6-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate |
|---|---|
| PubChem CID | 3830548 |
| Molecular Formula | C29H24ClN3O4 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | methyl 4-[6-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(Cc4ccccc4Cl)CC(=O)N32)cc1 |
| InChI | InChI=1S/C29H24ClN3O4/c1-37-29(36)18-12-10-17(11-13-18)27-26-21(20-7-3-5-9-23(20)31-26)14-24-28(35)32(16-25(34)33(24)27)15-19-6-2-4-8-22(19)30/h2-13,24,27,31H,14-16H2,1H3 |
| InChIKey | TZIIEZZDLCVTEU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|