C36H36N4O6 — CID 130275733
methyl 4-[[4-[[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]methyl]piperidin-1-yl]methyl]benzoate (PubChem CID 130275733) has the molecular formula C36H36N4O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is methyl 4-[[4-[[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]methyl]piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]methyl]piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 130275733 |
| Molecular Formula | C36H36N4O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | methyl 4-[[4-[[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]methyl]piperidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCC(CN3CC(=O)N4C(Cc5c([nH]c6ccccc56)C4c4ccc5c(c4)OCO5)C3=O)CC2)cc1 |
| InChI | InChI=1S/C36H36N4O6/c1-44-36(43)24-8-6-22(7-9-24)18-38-14-12-23(13-15-38)19-39-20-32(41)40-29(35(39)42)17-27-26-4-2-3-5-28(26)37-33(27)34(40)25-10-11-30-31(16-25)46-21-45-30/h2-11,16,23,29,34,37H,12-15,17-21H2,1H3 |
| InChIKey | HEQXXTCYKDECGM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|