C31H29N3O6 — CID 3711207
methyl 4-[6-[(3,4-dimethoxyphenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate (PubChem CID 3711207) has the molecular formula C31H29N3O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is methyl 4-[6-[(3,4-dimethoxyphenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate.
| Compound Name | methyl 4-[6-[(3,4-dimethoxyphenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate |
|---|---|
| PubChem CID | 3711207 |
| Molecular Formula | C31H29N3O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | methyl 4-[6-[(3,4-dimethoxyphenyl)methyl]-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(Cc4ccc(OC)c(OC)c4)CC(=O)N32)cc1 |
| InChI | InChI=1S/C31H29N3O6/c1-38-25-13-8-18(14-26(25)39-2)16-33-17-27(35)34-24(30(33)36)15-22-21-6-4-5-7-23(21)32-28(22)29(34)19-9-11-20(12-10-19)31(37)40-3/h4-14,24,29,32H,15-17H2,1-3H3 |
| InChIKey | MVUWBZIYDJBNGG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|