C33H35N3O7 — CID 44661785
(8R)-6-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 44661785) has the molecular formula C33H35N3O7 and a molecular weight of 585.66 g/mol. Its IUPAC name is (8R)-6-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8R)-6-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 44661785 |
| Molecular Formula | C33H35N3O7 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | (8R)-6-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc(CCN2CC(=O)N3C(c4cc(OC)c(OC)c(OC)c4)c4[nH]c5ccccc5c4C[C@@H]3C2=O)cc1OC |
| InChI | InChI=1S/C33H35N3O7/c1-39-25-11-10-19(14-26(25)40-2)12-13-35-18-29(37)36-24(33(35)38)17-22-21-8-6-7-9-23(21)34-30(22)31(36)20-15-27(41-3)32(43-5)28(16-20)42-4/h6-11,14-16,24,31,34H,12-13,17-18H2,1-5H3/t24-,31?/m1/s1 |
| InChIKey | WBRGRGUCVHHAQE-LZDHLTRGSA-N |
| XLogP | 4.14 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|