C28H33N3O4 — CID 3772665
2-(4-ethoxy-3-methoxyphenyl)-6-pentyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 3772665) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-(4-ethoxy-3-methoxyphenyl)-6-pentyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-(4-ethoxy-3-methoxyphenyl)-6-pentyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 3772665 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-(4-ethoxy-3-methoxyphenyl)-6-pentyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CCCCCN1CC(=O)N2C(Cc3c([nH]c4ccccc34)C2c2ccc(OCC)c(OC)c2)C1=O |
| InChI | InChI=1S/C28H33N3O4/c1-4-6-9-14-30-17-25(32)31-22(28(30)33)16-20-19-10-7-8-11-21(19)29-26(20)27(31)18-12-13-23(35-5-2)24(15-18)34-3/h7-8,10-13,15,22,27,29H,4-6,9,14,16-17H2,1-3H3 |
| InChIKey | VCMGWWNYBNXDCP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|