C26H27ClN4O3 — CID 135024504
N-tert-butyl-2-[(8S)-2-(4-chlorophenyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]acetamide (PubChem CID 135024504) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is N-tert-butyl-2-[(8S)-2-(4-chlorophenyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]acetamide.
| Compound Name | N-tert-butyl-2-[(8S)-2-(4-chlorophenyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]acetamide |
|---|---|
| PubChem CID | 135024504 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-tert-butyl-2-[(8S)-2-(4-chlorophenyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CC(=O)N2C(c3ccc(Cl)cc3)c3[nH]c4ccccc4c3C[C@H]2C1=O |
| InChI | InChI=1S/C26H27ClN4O3/c1-26(2,3)29-21(32)13-30-14-22(33)31-20(25(30)34)12-18-17-6-4-5-7-19(17)28-23(18)24(31)15-8-10-16(27)11-9-15/h4-11,20,24,28H,12-14H2,1-3H3,(H,29,32)/t20-,24?/m0/s1 |
| InChIKey | JDPLQODDAXJLTH-QHELBMECSA-N |
| XLogP | 3.42 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|