C24H24BrN3O2 — CID 71534627
(2R,8S)-2-(4-bromophenyl)-6-tert-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 71534627) has the molecular formula C24H24BrN3O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is (2R,8S)-2-(4-bromophenyl)-6-tert-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8S)-2-(4-bromophenyl)-6-tert-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 71534627 |
| Molecular Formula | C24H24BrN3O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (2R,8S)-2-(4-bromophenyl)-6-tert-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC(C)(C)N1CC(=O)N2[C@H](c3ccc(Br)cc3)c3[nH]c4ccccc4c3C[C@H]2C1=O |
| InChI | InChI=1S/C24H24BrN3O2/c1-24(2,3)27-13-20(29)28-19(23(27)30)12-17-16-6-4-5-7-18(16)26-21(17)22(28)14-8-10-15(25)11-9-14/h4-11,19,22,26H,12-13H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | YCZRIAFDGQJROM-SIKLNZKXSA-N |
| XLogP | 4.41 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|