C23H20F3N3O3 — CID 22132300
2-(4-methoxyphenyl)-6-(2,2,2-trifluoroethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 22132300) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-(2,2,2-trifluoroethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-(4-methoxyphenyl)-6-(2,2,2-trifluoroethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 22132300 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-(2,2,2-trifluoroethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(CC(F)(F)F)CC(=O)N32)cc1 |
| InChI | InChI=1S/C23H20F3N3O3/c1-32-14-8-6-13(7-9-14)21-20-16(15-4-2-3-5-17(15)27-20)10-18-22(31)28(12-23(24,25)26)11-19(30)29(18)21/h2-9,18,21,27H,10-12H2,1H3 |
| InChIKey | AMPDAXAXYIHODK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|