C21H19BrF4N2O — CID 155032503
1-(3-bromo-2-fluoro-6-methoxyphenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 155032503) has the molecular formula C21H19BrF4N2O and a molecular weight of 471.29 g/mol. Its IUPAC name is 1-(3-bromo-2-fluoro-6-methoxyphenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(3-bromo-2-fluoro-6-methoxyphenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155032503 |
| Molecular Formula | C21H19BrF4N2O |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-(3-bromo-2-fluoro-6-methoxyphenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc(Br)c(F)c1C1c2[nH]c3ccccc3c2CC(C)N1CC(F)(F)F |
| InChI | InChI=1S/C21H19BrF4N2O/c1-11-9-13-12-5-3-4-6-15(12)27-19(13)20(28(11)10-21(24,25)26)17-16(29-2)8-7-14(22)18(17)23/h3-8,11,20,27H,9-10H2,1-2H3 |
| InChIKey | JLKALPRSFQNEBQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|