C27H30F5N3O — CID 160571160
1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 160571160) has the molecular formula C27H30F5N3O and a molecular weight of 507.55 g/mol. Its IUPAC name is 1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 160571160 |
| Molecular Formula | C27H30F5N3O |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCC1CN(CCOc2cc(F)c(C3c4[nH]c5ccccc5c4CC(C)N3CC(F)(F)F)c(F)c2)C1 |
| InChI | InChI=1S/C27H30F5N3O/c1-3-17-13-34(14-17)8-9-36-18-11-21(28)24(22(29)12-18)26-25-20(19-6-4-5-7-23(19)33-25)10-16(2)35(26)15-27(30,31)32/h4-7,11-12,16-17,26,33H,3,8-10,13-15H2,1-2H3 |
| InChIKey | RAOKVPKXJLRUFX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|