C30H37F2N3O2 — CID 157434167
1-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 157434167) has the molecular formula C30H37F2N3O2 and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 157434167 |
| Molecular Formula | C30H37F2N3O2 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 1-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CCC1CN(CCOc2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3C(=O)C(C)(C)C)c(F)c2)C1 |
| InChI | InChI=1S/C30H37F2N3O2/c1-6-19-16-34(17-19)11-12-37-20-14-23(31)26(24(32)15-20)28-27-22(21-9-7-8-10-25(21)33-27)13-18(2)35(28)29(36)30(3,4)5/h7-10,14-15,18-19,28,33H,6,11-13,16-17H2,1-5H3/t18-,28-/m1/s1 |
| InChIKey | KEBCREDKGJDEKO-KWMCUTETSA-N |
| XLogP | 6.08 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|