C31H40F2N4O2 — CID 159344405
(2S)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N,N,2-trimethylpropanamide (PubChem CID 159344405) has the molecular formula C31H40F2N4O2 and a molecular weight of 538.68 g/mol. Its IUPAC name is (2S)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N,N,2-trimethylpropanamide.
| Compound Name | (2S)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 159344405 |
| Molecular Formula | C31H40F2N4O2 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | (2S)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N,N,2-trimethylpropanamide |
| SMILES | CCC1CN(CCOc2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3C[C@H](C)C(=O)N(C)C)c(F)c2)C1 |
| InChI | InChI=1S/C31H40F2N4O2/c1-6-21-17-36(18-21)11-12-39-22-14-25(32)28(26(33)15-22)30-29-24(23-9-7-8-10-27(23)34-29)13-20(3)37(30)16-19(2)31(38)35(4)5/h7-10,14-15,19-21,30,34H,6,11-13,16-18H2,1-5H3/t19-,20+,30+/m0/s1 |
| InChIKey | UGGRBYAZFZRJEH-FHFCDEBKSA-N |
| XLogP | 5.23 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|