C23H24F2N2O3 — CID 138726994
methyl (2S)-3-[(1R,3R)-1-(2,6-difluoro-4-hydroxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate (PubChem CID 138726994) has the molecular formula C23H24F2N2O3 and a molecular weight of 414.45 g/mol. Its IUPAC name is methyl (2S)-3-[(1R,3R)-1-(2,6-difluoro-4-hydroxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[(1R,3R)-1-(2,6-difluoro-4-hydroxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 138726994 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | methyl (2S)-3-[(1R,3R)-1-(2,6-difluoro-4-hydroxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)CN1[C@H](c2c(F)cc(O)cc2F)c2[nH]c3ccccc3c2C[C@H]1C |
| InChI | InChI=1S/C23H24F2N2O3/c1-12(23(29)30-3)11-27-13(2)8-16-15-6-4-5-7-19(15)26-21(16)22(27)20-17(24)9-14(28)10-18(20)25/h4-7,9-10,12-13,22,26,28H,8,11H2,1-3H3/t12-,13+,22+/m0/s1 |
| InChIKey | ZPKJQBTUWVIQEF-UAGWRWDDSA-N |
| XLogP | 4.30 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|