C24H28BrF3N2O — CID 153378698
2-[[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-3-fluoropropan-1-ol;ethane (PubChem CID 153378698) has the molecular formula C24H28BrF3N2O and a molecular weight of 497.40 g/mol. Its IUPAC name is 2-[[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-3-fluoropropan-1-ol;ethane.
| Compound Name | 2-[[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-3-fluoropropan-1-ol;ethane |
|---|---|
| PubChem CID | 153378698 |
| Molecular Formula | C24H28BrF3N2O |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2-[[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-3-fluoropropan-1-ol;ethane |
| SMILES | CC.CC1Cc2c([nH]c3ccccc23)C(c2c(F)cc(Br)cc2F)N1CC(CO)CF |
| InChI | InChI=1S/C22H22BrF3N2O.C2H6/c1-12-6-16-15-4-2-3-5-19(15)27-21(16)22(28(12)10-13(9-24)11-29)20-17(25)7-14(23)8-18(20)26;1-2/h2-5,7-8,12-13,22,27,29H,6,9-11H2,1H3;1-2H3 |
| InChIKey | YGQOJAWYMJOIIY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|