C28H31F3N2 — CID 145378165
(1R,3R)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-[(3-ethyl-3-fluorocyclobutyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 145378165) has the molecular formula C28H31F3N2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (1R,3R)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-[(3-ethyl-3-fluorocyclobutyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-[(3-ethyl-3-fluorocyclobutyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 145378165 |
| Molecular Formula | C28H31F3N2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (1R,3R)-1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-[(3-ethyl-3-fluorocyclobutyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C/C=C/c1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC2CC(F)(CC)C2)c(F)c1 |
| InChI | InChI=1S/C28H31F3N2/c1-4-8-18-12-22(29)25(23(30)13-18)27-26-21(20-9-6-7-10-24(20)32-26)11-17(3)33(27)16-19-14-28(31,5-2)15-19/h4,6-10,12-13,17,19,27,32H,5,11,14-16H2,1-3H3/b8-4+/t17-,19?,27-,28?/m1/s1 |
| InChIKey | FTJVCRJJGMSLLQ-DBZVSNDLSA-N |
| XLogP | 7.34 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|