C21H17F3N2 — CID 139446947
(1S,3S)-3-methyl-2-prop-2-ynyl-1-(2,4,6-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 139446947) has the molecular formula C21H17F3N2 and a molecular weight of 354.38 g/mol. Its IUPAC name is (1S,3S)-3-methyl-2-prop-2-ynyl-1-(2,4,6-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3S)-3-methyl-2-prop-2-ynyl-1-(2,4,6-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 139446947 |
| Molecular Formula | C21H17F3N2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (1S,3S)-3-methyl-2-prop-2-ynyl-1-(2,4,6-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C#CCN1[C@@H](c2c(F)cc(F)cc2F)c2[nH]c3ccccc3c2C[C@@H]1C |
| InChI | InChI=1S/C21H17F3N2/c1-3-8-26-12(2)9-15-14-6-4-5-7-18(14)25-20(15)21(26)19-16(23)10-13(22)11-17(19)24/h1,4-7,10-12,21,25H,8-9H2,2H3/t12-,21-/m0/s1 |
| InChIKey | BIFINLIRCKTJCP-QKVFXAPYSA-N |
| XLogP | 4.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|