C24H27F3N2O2 — CID 167697895
3-[1-(4-ethoxy-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol (PubChem CID 167697895) has the molecular formula C24H27F3N2O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 3-[1-(4-ethoxy-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol.
| Compound Name | 3-[1-(4-ethoxy-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 167697895 |
| Molecular Formula | C24H27F3N2O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-[1-(4-ethoxy-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
| SMILES | CCOc1cc(F)c(C2c3[nH]c4ccccc4c3CC(C)N2CC(C)(F)CO)c(F)c1 |
| InChI | InChI=1S/C24H27F3N2O2/c1-4-31-15-10-18(25)21(19(26)11-15)23-22-17(16-7-5-6-8-20(16)28-22)9-14(2)29(23)12-24(3,27)13-30/h5-8,10-11,14,23,28,30H,4,9,12-13H2,1-3H3 |
| InChIKey | KURIMEJTFFDBPM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|