C23H27F2N3O — CID 121427704
(1S,3R)-1-(5-ethoxy-3-fluoro-2-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 121427704) has the molecular formula C23H27F2N3O and a molecular weight of 399.49 g/mol. Its IUPAC name is (1S,3R)-1-(5-ethoxy-3-fluoro-2-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3R)-1-(5-ethoxy-3-fluoro-2-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 121427704 |
| Molecular Formula | C23H27F2N3O |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (1S,3R)-1-(5-ethoxy-3-fluoro-2-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCOc1cnc([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C23H27F2N3O/c1-5-29-15-11-18(24)21(26-12-15)22-20-17(16-8-6-7-9-19(16)27-20)10-14(2)28(22)13-23(3,4)25/h6-9,11-12,14,22,27H,5,10,13H2,1-4H3/t14-,22+/m1/s1 |
| InChIKey | NPMHIKBQZZCLHC-PEBXRYMYSA-N |
| XLogP | 5.18 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|