C27H32F5N3O — CID 134199609
N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,3-difluoropropan-1-amine (PubChem CID 134199609) has the molecular formula C27H32F5N3O and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,3-difluoropropan-1-amine.
| Compound Name | N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 134199609 |
| Molecular Formula | C27H32F5N3O |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,3-difluoropropan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCNCCC(F)F)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C27H32F5N3O/c1-16-12-19-18-6-4-5-7-22(18)34-25(19)26(35(16)15-27(2,3)32)24-20(28)13-17(14-21(24)29)36-11-10-33-9-8-23(30)31/h4-7,13-14,16,23,26,33-34H,8-12,15H2,1-3H3/t16-,26-/m1/s1 |
| InChIKey | PEPBBPQEUYVKQU-AKJBCIBTSA-N |
| XLogP | 6.15 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|