C33H45F3N4O3 — CID 138726830
ethyl 5-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethylamino]ethylamino]pentanoate (PubChem CID 138726830) has the molecular formula C33H45F3N4O3 and a molecular weight of 602.74 g/mol. Its IUPAC name is ethyl 5-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethylamino]ethylamino]pentanoate.
| Compound Name | ethyl 5-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethylamino]ethylamino]pentanoate |
|---|---|
| PubChem CID | 138726830 |
| Molecular Formula | C33H45F3N4O3 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | ethyl 5-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethylamino]ethylamino]pentanoate |
| SMILES | CCOC(=O)CCCCNCCNCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C33H45F3N4O3/c1-5-42-29(41)12-8-9-13-37-14-15-38-16-17-43-23-19-26(34)30(27(35)20-23)32-31-25(24-10-6-7-11-28(24)39-31)18-22(2)40(32)21-33(3,4)36/h6-7,10-11,19-20,22,32,37-39H,5,8-9,12-18,21H2,1-4H3/t22-,32-/m1/s1 |
| InChIKey | HMASWINWFBLOKA-APYJYERMSA-N |
| XLogP | 5.82 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|