C33H43F3N2O5 — CID 138693574
ethyl 2-[7-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-4-hydroxyheptoxy]acetate (PubChem CID 138693574) has the molecular formula C33H43F3N2O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is ethyl 2-[7-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-4-hydroxyheptoxy]acetate.
| Compound Name | ethyl 2-[7-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-4-hydroxyheptoxy]acetate |
|---|---|
| PubChem CID | 138693574 |
| Molecular Formula | C33H43F3N2O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | ethyl 2-[7-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-4-hydroxyheptoxy]acetate |
| SMILES | CCOC(=O)COCCCC(O)CCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C33H43F3N2O5/c1-5-42-29(40)19-41-14-8-10-22(39)11-9-15-43-23-17-26(34)30(27(35)18-23)32-31-25(24-12-6-7-13-28(24)37-31)16-21(2)38(32)20-33(3,4)36/h6-7,12-13,17-18,21-22,32,37,39H,5,8-11,14-16,19-20H2,1-4H3/t21-,22?,32-/m1/s1 |
| InChIKey | IFHGWYQONRHRFF-NNDKEMDOSA-N |
| XLogP | 6.41 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|