C32H41F3N4O4 — CID 138693199
2-[2-[4-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]piperazin-1-yl]ethoxy]acetic acid (PubChem CID 138693199) has the molecular formula C32H41F3N4O4 and a molecular weight of 602.70 g/mol. Its IUPAC name is 2-[2-[4-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]piperazin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]piperazin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 138693199 |
| Molecular Formula | C32H41F3N4O4 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 2-[2-[4-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]piperazin-1-yl]ethoxy]acetic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CCN(CCOCC(=O)O)CC3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C32H41F3N4O4/c1-21-16-24-23-6-4-5-7-27(23)36-30(24)31(39(21)20-32(2,3)35)29-25(33)17-22(18-26(29)34)43-15-13-38-10-8-37(9-11-38)12-14-42-19-28(40)41/h4-7,17-18,21,31,36H,8-16,19-20H2,1-3H3,(H,40,41)/t21-,31-/m1/s1 |
| InChIKey | HUVVWDAISQBWQG-ROTAYESASA-N |
| XLogP | 4.63 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|