C27H31F4N3O — CID 130330711
(1R,3R)-2-(2,2-difluoropropyl)-1-[2,6-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 130330711) has the molecular formula C27H31F4N3O and a molecular weight of 489.56 g/mol. Its IUPAC name is (1R,3R)-2-(2,2-difluoropropyl)-1-[2,6-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-2-(2,2-difluoropropyl)-1-[2,6-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 130330711 |
| Molecular Formula | C27H31F4N3O |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (1R,3R)-2-(2,2-difluoropropyl)-1-[2,6-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CCCC3)cc2F)N1CC(C)(F)F |
| InChI | InChI=1S/C27H31F4N3O/c1-17-13-20-19-7-3-4-8-23(19)32-25(20)26(34(17)16-27(2,30)31)24-21(28)14-18(15-22(24)29)35-12-11-33-9-5-6-10-33/h3-4,7-8,14-15,17,26,32H,5-6,9-13,16H2,1-2H3/t17-,26-/m1/s1 |
| InChIKey | STHLKSIISWJDMJ-WGDIFIGCSA-N |
| XLogP | 5.91 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|