C26H32F2N2O — CID 163785399
(1R,3R)-1-(2,6-difluoro-4-propoxyphenyl)-2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 163785399) has the molecular formula C26H32F2N2O and a molecular weight of 426.55 g/mol. Its IUPAC name is (1R,3R)-1-(2,6-difluoro-4-propoxyphenyl)-2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(2,6-difluoro-4-propoxyphenyl)-2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 163785399 |
| Molecular Formula | C26H32F2N2O |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (1R,3R)-1-(2,6-difluoro-4-propoxyphenyl)-2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C26H32F2N2O/c1-6-11-31-17-13-20(27)23(21(28)14-17)25-24-19(18-9-7-8-10-22(18)29-24)12-16(2)30(25)15-26(3,4)5/h7-10,13-14,16,25,29H,6,11-12,15H2,1-5H3/t16-,25-/m1/s1 |
| InChIKey | MSCLYPLSQAAFCG-PUAOIOHZSA-N |
| XLogP | 6.62 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|