C34H45F3N2O4 — CID 138693801
ethyl 2-[8-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]octoxy]acetate (PubChem CID 138693801) has the molecular formula C34H45F3N2O4 and a molecular weight of 602.74 g/mol. Its IUPAC name is ethyl 2-[8-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]octoxy]acetate.
| Compound Name | ethyl 2-[8-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]octoxy]acetate |
|---|---|
| PubChem CID | 138693801 |
| Molecular Formula | C34H45F3N2O4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | ethyl 2-[8-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]octoxy]acetate |
| SMILES | CCOC(=O)COCCCCCCCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C34H45F3N2O4/c1-5-42-30(40)21-41-16-12-8-6-7-9-13-17-43-24-19-27(35)31(28(36)20-24)33-32-26(25-14-10-11-15-29(25)38-32)18-23(2)39(33)22-34(3,4)37/h10-11,14-15,19-20,23,33,38H,5-9,12-13,16-18,21-22H2,1-4H3/t23-,33-/m1/s1 |
| InChIKey | VIVGQPSBTQBQDT-PVAZPRTOSA-N |
| XLogP | 7.83 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|