C32H39F5N2O5 — CID 138693390
ethyl 2-[2-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]ethoxy]-2,2-difluoroacetate (PubChem CID 138693390) has the molecular formula C32H39F5N2O5 and a molecular weight of 626.66 g/mol. Its IUPAC name is ethyl 2-[2-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]ethoxy]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[2-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]ethoxy]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 138693390 |
| Molecular Formula | C32H39F5N2O5 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | ethyl 2-[2-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]ethoxy]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)OCCOCCCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C32H39F5N2O5/c1-5-42-30(40)32(36,37)44-15-14-41-12-8-9-13-43-21-17-24(33)27(25(34)18-21)29-28-23(22-10-6-7-11-26(22)38-28)16-20(2)39(29)19-31(3,4)35/h6-7,10-11,17-18,20,29,38H,5,8-9,12-16,19H2,1-4H3/t20-,29-/m1/s1 |
| InChIKey | ZHOPGBVSKITCSK-ACSYHNTCSA-N |
| XLogP | 6.88 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|