C29H33F5N2O5 — CID 138693434
ethyl 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetate (PubChem CID 138693434) has the molecular formula C29H33F5N2O5 and a molecular weight of 584.58 g/mol. Its IUPAC name is ethyl 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetate.
| Compound Name | ethyl 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetate |
|---|---|
| PubChem CID | 138693434 |
| Molecular Formula | C29H33F5N2O5 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | ethyl 2-[3-[2-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethoxy]propoxy]acetate |
| SMILES | CCOC(=O)COCCCOCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C29H33F5N2O5/c1-3-40-25(37)16-39-10-6-9-38-11-12-41-19-14-22(30)26(23(31)15-19)28-27-21(20-7-4-5-8-24(20)35-27)13-18(2)36(28)17-29(32,33)34/h4-5,7-8,14-15,18,28,35H,3,6,9-13,16-17H2,1-2H3/t18-,28-/m1/s1 |
| InChIKey | DMQGTHOUOXZPQN-KWMCUTETSA-N |
| XLogP | 5.71 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|