C33H35F3N2O4 — CID 138693412
ethyl 2-[3-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]phenoxy]acetate (PubChem CID 138693412) has the molecular formula C33H35F3N2O4 and a molecular weight of 580.65 g/mol. Its IUPAC name is ethyl 2-[3-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 138693412 |
| Molecular Formula | C33H35F3N2O4 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | ethyl 2-[3-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(COc2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(C)(C)F)c(F)c2)c1 |
| InChI | InChI=1S/C33H35F3N2O4/c1-5-40-29(39)18-42-22-10-8-9-21(14-22)17-41-23-15-26(34)30(27(35)16-23)32-31-25(24-11-6-7-12-28(24)37-31)13-20(2)38(32)19-33(3,4)36/h6-12,14-16,20,32,37H,5,13,17-19H2,1-4H3/t20-,32-/m1/s1 |
| InChIKey | XBVDQPVHEKZXGX-QTYPKTMWSA-N |
| XLogP | 7.05 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|