C30H35F5N2O4 — CID 138693311
2-[6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexoxy]-2,2-difluoroacetic acid (PubChem CID 138693311) has the molecular formula C30H35F5N2O4 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-[6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexoxy]-2,2-difluoroacetic acid.
| Compound Name | 2-[6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexoxy]-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 138693311 |
| Molecular Formula | C30H35F5N2O4 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 2-[6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexoxy]-2,2-difluoroacetic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCCCCCOC(F)(F)C(=O)O)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C30H35F5N2O4/c1-18-14-21-20-10-6-7-11-24(20)36-26(21)27(37(18)17-29(2,3)33)25-22(31)15-19(16-23(25)32)40-12-8-4-5-9-13-41-30(34,35)28(38)39/h6-7,10-11,15-16,18,27,36H,4-5,8-9,12-14,17H2,1-3H3,(H,38,39)/t18-,27-/m1/s1 |
| InChIKey | JEYDBBSAJMJZEG-DNOBIOAJSA-N |
| XLogP | 7.16 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|