C27H30F3N3O2 — CID 151368805
N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]prop-2-enamide (PubChem CID 151368805) has the molecular formula C27H30F3N3O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]prop-2-enamide.
| Compound Name | N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 151368805 |
| Molecular Formula | C27H30F3N3O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCOc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C27H30F3N3O2/c1-5-23(34)31-10-11-35-17-13-20(28)24(21(29)14-17)26-25-19(18-8-6-7-9-22(18)32-25)12-16(2)33(26)15-27(3,4)30/h5-9,13-14,16,26,32H,1,10-12,15H2,2-4H3,(H,31,34)/t16-,26-/m1/s1 |
| InChIKey | OPZLYQIHHMUWDB-AKJBCIBTSA-N |
| XLogP | 5.21 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|