C28H33F4N3O4 — CID 164889457
tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoro-3-hydroxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]carbamate (PubChem CID 164889457) has the molecular formula C28H33F4N3O4 and a molecular weight of 551.58 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoro-3-hydroxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoro-3-hydroxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 164889457 |
| Molecular Formula | C28H33F4N3O4 |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoro-3-hydroxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]carbamate |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCNC(=O)OC(C)(C)C)cc2F)N1CC(F)(F)CO |
| InChI | InChI=1S/C28H33F4N3O4/c1-16-11-19-18-7-5-6-8-22(18)34-24(19)25(35(16)14-28(31,32)15-36)23-20(29)12-17(13-21(23)30)38-10-9-33-26(37)39-27(2,3)4/h5-8,12-13,16,25,34,36H,9-11,14-15H2,1-4H3,(H,33,37)/t16-,25-/m1/s1 |
| InChIKey | JSWFBLAOKPPKOA-PUAOIOHZSA-N |
| XLogP | 5.31 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|