C30H37F4N3O5 — CID 138693465
ethyl 2-[2-[5-[[5-fluoro-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]pentoxy]ethoxy]acetate (PubChem CID 138693465) has the molecular formula C30H37F4N3O5 and a molecular weight of 595.63 g/mol. Its IUPAC name is ethyl 2-[2-[5-[[5-fluoro-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]pentoxy]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[5-[[5-fluoro-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]pentoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 138693465 |
| Molecular Formula | C30H37F4N3O5 |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | ethyl 2-[2-[5-[[5-fluoro-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]pentoxy]ethoxy]acetate |
| SMILES | CCOC(=O)COCCOCCCCCOc1cnc([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C30H37F4N3O5/c1-3-41-26(38)18-40-14-13-39-11-7-4-8-12-42-21-16-24(31)28(35-17-21)29-27-23(22-9-5-6-10-25(22)36-27)15-20(2)37(29)19-30(32,33)34/h5-6,9-10,16-17,20,29,36H,3-4,7-8,11-15,18-19H2,1-2H3/t20-,29+/m1/s1 |
| InChIKey | MJVHBYVLCRZSOY-OLILMLBXSA-N |
| XLogP | 5.75 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|