C30H39F2N3O5 — CID 138693492
ethyl 2-[5-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]pentoxy]acetate (PubChem CID 138693492) has the molecular formula C30H39F2N3O5 and a molecular weight of 559.65 g/mol. Its IUPAC name is ethyl 2-[5-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]pentoxy]acetate.
| Compound Name | ethyl 2-[5-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]pentoxy]acetate |
|---|---|
| PubChem CID | 138693492 |
| Molecular Formula | C30H39F2N3O5 |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | ethyl 2-[5-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]pentoxy]acetate |
| SMILES | CCOC(=O)COCCCCCOCCOc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(F)F)nc1 |
| InChI | InChI=1S/C30H39F2N3O5/c1-3-39-28(36)20-38-14-8-4-7-13-37-15-16-40-22-11-12-26(33-18-22)30-29-24(17-21(2)35(30)19-27(31)32)23-9-5-6-10-25(23)34-29/h5-6,9-12,18,21,27,30,34H,3-4,7-8,13-17,19-20H2,1-2H3/t21-,30-/m1/s1 |
| InChIKey | NRISACRQMLJRND-IIMAJNMQSA-N |
| XLogP | 5.31 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|