C31H40F3N3O4 — CID 134199695
tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate (PubChem CID 134199695) has the molecular formula C31H40F3N3O4 and a molecular weight of 575.67 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate.
| Compound Name | tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 134199695 |
| Molecular Formula | C31H40F3N3O4 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | tert-butyl N-[2-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-methoxyphenoxy]ethyl]-N-(3-fluoropropyl)carbamate |
| SMILES | COc1cc(OCCN(CCCF)C(=O)OC(C)(C)C)ccc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)F |
| InChI | InChI=1S/C31H40F3N3O4/c1-20-17-24-22-9-6-7-10-25(22)35-28(24)29(37(20)19-27(33)34)23-12-11-21(18-26(23)39-5)40-16-15-36(14-8-13-32)30(38)41-31(2,3)4/h6-7,9-12,18,20,27,29,35H,8,13-17,19H2,1-5H3/t20-,29-/m1/s1 |
| InChIKey | QHAYJCBRRLJLOO-ACSYHNTCSA-N |
| XLogP | 6.75 |
| TPSA | 67.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|