C28H34F3N3O2 — CID 121425631
(2R)-2-fluoro-3-[(1R,3R)-1-[2-fluoro-4-[2-[1-(fluoromethyl)azetidin-3-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol (PubChem CID 121425631) has the molecular formula C28H34F3N3O2 and a molecular weight of 501.59 g/mol. Its IUPAC name is (2R)-2-fluoro-3-[(1R,3R)-1-[2-fluoro-4-[2-[1-(fluoromethyl)azetidin-3-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol.
| Compound Name | (2R)-2-fluoro-3-[(1R,3R)-1-[2-fluoro-4-[2-[1-(fluoromethyl)azetidin-3-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 121425631 |
| Molecular Formula | C28H34F3N3O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | (2R)-2-fluoro-3-[(1R,3R)-1-[2-fluoro-4-[2-[1-(fluoromethyl)azetidin-3-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OCCC3CN(CF)C3)cc2F)N1C[C@@](C)(F)CO |
| InChI | InChI=1S/C28H34F3N3O2/c1-18-11-23-21-5-3-4-6-25(21)32-26(23)27(34(18)15-28(2,31)16-35)22-8-7-20(12-24(22)30)36-10-9-19-13-33(14-19)17-29/h3-8,12,18-19,27,32,35H,9-11,13-17H2,1-2H3/t18-,27-,28-/m1/s1 |
| InChIKey | HTCFGUFPOYGDOC-WMEVLASGSA-N |
| XLogP | 4.99 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|