C22H25FN2O — CID 145102463
(1S,3R)-1-(2-fluoro-4-propoxyphenyl)-2,3-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 145102463) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (1S,3R)-1-(2-fluoro-4-propoxyphenyl)-2,3-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3R)-1-(2-fluoro-4-propoxyphenyl)-2,3-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 145102463 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1S,3R)-1-(2-fluoro-4-propoxyphenyl)-2,3-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCOc1ccc([C@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2C)c(F)c1 |
| InChI | InChI=1S/C22H25FN2O/c1-4-11-26-15-9-10-17(19(23)13-15)22-21-18(12-14(2)25(22)3)16-7-5-6-8-20(16)24-21/h5-10,13-14,22,24H,4,11-12H2,1-3H3/t14-,22+/m1/s1 |
| InChIKey | SEHLWJQHTPBSPS-PEBXRYMYSA-N |
| XLogP | 5.06 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|