C28H34F3N3O — CID 121410521
(1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 121410521) has the molecular formula C28H34F3N3O and a molecular weight of 485.59 g/mol. Its IUPAC name is (1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 121410521 |
| Molecular Formula | C28H34F3N3O |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | (1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OC3CN(CCCF)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C28H34F3N3O/c1-18-13-23-21-7-4-5-8-25(21)32-26(23)27(34(18)17-28(2,3)31)22-10-9-19(14-24(22)30)35-20-15-33(16-20)12-6-11-29/h4-5,7-10,14,18,20,27,32H,6,11-13,15-17H2,1-3H3/t18-,27-/m1/s1 |
| InChIKey | BHYRGSSITHMDGQ-DNOBIOAJSA-N |
| XLogP | 5.81 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|