C27H29F7N4O — CID 171059591
N-[5-(difluoromethoxy)-2-fluoro-4-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 171059591) has the molecular formula C27H29F7N4O and a molecular weight of 558.54 g/mol. Its IUPAC name is N-[5-(difluoromethoxy)-2-fluoro-4-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[5-(difluoromethoxy)-2-fluoro-4-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 171059591 |
| Molecular Formula | C27H29F7N4O |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | N-[5-(difluoromethoxy)-2-fluoro-4-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)C(c2cc(F)c(NC3CN(CCCF)C3)cc2OC(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C27H29F7N4O/c1-15-9-18-17-5-2-3-6-21(17)36-24(18)25(38(15)14-27(32,33)34)19-10-20(29)22(11-23(19)39-26(30)31)35-16-12-37(13-16)8-4-7-28/h2-3,5-6,10-11,15-16,25-26,35-36H,4,7-9,12-14H2,1H3/t15-,25?/m1/s1 |
| InChIKey | JPRRNRSYANCBPC-FXBVVIMESA-N |
| XLogP | 6.26 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|