C27H29F7N4 — CID 169318006
(3S,4S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 169318006) has the molecular formula C27H29F7N4 and a molecular weight of 542.54 g/mol. Its IUPAC name is (3S,4S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S,4S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 169318006 |
| Molecular Formula | C27H29F7N4 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | (3S,4S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-4-fluoro-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N[C@H]3CN(CCCF)C[C@@H]3F)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C27H29F7N4/c1-15-9-18-17-5-2-3-6-22(17)36-25(18)26(38(15)14-27(32,33)34)24-19(29)10-16(11-20(24)30)35-23-13-37(8-4-7-28)12-21(23)31/h2-3,5-6,10-11,15,21,23,26,35-36H,4,7-9,12-14H2,1H3/t15-,21+,23+,26-/m1/s1 |
| InChIKey | RPRVNPOEWZIUOY-OQIKBYJPSA-N |
| XLogP | 6.14 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|