C28H32F6N4 — CID 166849369
N-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)-5-methylpyrrolidin-3-amine (PubChem CID 166849369) has the molecular formula C28H32F6N4 and a molecular weight of 538.58 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)-5-methylpyrrolidin-3-amine.
| Compound Name | N-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)-5-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 166849369 |
| Molecular Formula | C28H32F6N4 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)-5-methylpyrrolidin-3-amine |
| SMILES | CC1CC(Nc2cc(F)c(C3c4[nH]c5ccccc5c4CC(C)N3CC(F)(F)F)c(F)c2)CN1CCCF |
| InChI | InChI=1S/C28H32F6N4/c1-16-10-19(14-37(16)9-5-8-29)35-18-12-22(30)25(23(31)13-18)27-26-21(20-6-3-4-7-24(20)36-26)11-17(2)38(27)15-28(32,33)34/h3-4,6-7,12-13,16-17,19,27,35-36H,5,8-11,14-15H2,1-2H3 |
| InChIKey | WALPERUSPCBJSZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|