C27H28F5N5 — CID 164855412
4-[3-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]azetidin-1-yl]butanenitrile (PubChem CID 164855412) has the molecular formula C27H28F5N5 and a molecular weight of 517.55 g/mol. Its IUPAC name is 4-[3-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]azetidin-1-yl]butanenitrile.
| Compound Name | 4-[3-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]azetidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 164855412 |
| Molecular Formula | C27H28F5N5 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 4-[3-[3,5-difluoro-4-[3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]azetidin-1-yl]butanenitrile |
| SMILES | CC1Cc2c([nH]c3ccccc23)C(c2c(F)cc(NC3CN(CCCC#N)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C27H28F5N5/c1-16-10-20-19-6-2-3-7-23(19)35-25(20)26(37(16)15-27(30,31)32)24-21(28)11-17(12-22(24)29)34-18-13-36(14-18)9-5-4-8-33/h2-3,6-7,11-12,16,18,26,34-35H,4-5,9-10,13-15H2,1H3 |
| InChIKey | SPDICWRVMDHHQQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|