C28H35ClF2N4O — CID 157252055
3-[1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloropropan-1-ol (PubChem CID 157252055) has the molecular formula C28H35ClF2N4O and a molecular weight of 517.06 g/mol. Its IUPAC name is 3-[1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloropropan-1-ol.
| Compound Name | 3-[1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloropropan-1-ol |
|---|---|
| PubChem CID | 157252055 |
| Molecular Formula | C28H35ClF2N4O |
| Molecular Weight | 517.06 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-[1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloropropan-1-ol |
| SMILES | CCCCN1CC(Nc2cc(F)c(C3c4[nH]c5ccccc5c4CC(C)N3CC(Cl)CO)c(F)c2)C1 |
| InChI | InChI=1S/C28H35ClF2N4O/c1-3-4-9-34-14-20(15-34)32-19-11-23(30)26(24(31)12-19)28-27-22(21-7-5-6-8-25(21)33-27)10-17(2)35(28)13-18(29)16-36/h5-8,11-12,17-18,20,28,32-33,36H,3-4,9-10,13-16H2,1-2H3 |
| InChIKey | BPDXXRCCMABONV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.06 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|