C31H37F3N4O — CID 164561488
(1R)-1-[3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]ethanol (PubChem CID 164561488) has the molecular formula C31H37F3N4O and a molecular weight of 538.66 g/mol. Its IUPAC name is (1R)-1-[3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]ethanol.
| Compound Name | (1R)-1-[3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]ethanol |
|---|---|
| PubChem CID | 164561488 |
| Molecular Formula | C31H37F3N4O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (1R)-1-[3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]ethanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1C12CC([C@@H](C)O)(C1)C2 |
| InChI | InChI=1S/C31H37F3N4O/c1-18-10-23-22-6-3-4-7-26(22)36-28(23)29(38(18)31-15-30(16-31,17-31)19(2)39)27-24(33)11-20(12-25(27)34)35-21-13-37(14-21)9-5-8-32/h3-4,6-7,11-12,18-19,21,29,35-36,39H,5,8-10,13-17H2,1-2H3/t18-,19-,29-,30?,31?/m1/s1 |
| InChIKey | FYOJUHZCWIWSNW-FRNHEKQMSA-N |
| XLogP | 5.54 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|