C29H35F3N4 — CID 167072874
(3S)-N-[4-[(1R,3R)-2-but-1-en-2-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 167072874) has the molecular formula C29H35F3N4 and a molecular weight of 496.62 g/mol. Its IUPAC name is (3S)-N-[4-[(1R,3R)-2-but-1-en-2-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[4-[(1R,3R)-2-but-1-en-2-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 167072874 |
| Molecular Formula | C29H35F3N4 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (3S)-N-[4-[(1R,3R)-2-but-1-en-2-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C=C(CC)N1[C@H](c2c(F)cc(N[C@H]3CCN(CCCF)C3)cc2F)c2[nH]c3ccccc3c2C[C@H]1C |
| InChI | InChI=1S/C29H35F3N4/c1-4-18(2)36-19(3)14-23-22-8-5-6-9-26(22)34-28(23)29(36)27-24(31)15-21(16-25(27)32)33-20-10-13-35(17-20)12-7-11-30/h5-6,8-9,15-16,19-20,29,33-34H,2,4,7,10-14,17H2,1,3H3/t19-,20+,29-/m1/s1 |
| InChIKey | LFJRYQAQRJGUPM-WAPJKPAKSA-N |
| XLogP | 6.55 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|