C30H35F3N4 — CID 167141782
N-[4-[(1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 167141782) has the molecular formula C30H35F3N4 and a molecular weight of 508.63 g/mol. Its IUPAC name is N-[4-[(1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 167141782 |
| Molecular Formula | C30H35F3N4 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | N-[4-[(1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1[C@@H]1CC2CC1C2 |
| InChI | InChI=1S/C30H35F3N4/c1-17-9-23-22-5-2-3-6-26(22)35-29(23)30(37(17)27-12-18-10-19(27)11-18)28-24(32)13-20(14-25(28)33)34-21-15-36(16-21)8-4-7-31/h2-3,5-6,13-14,17-19,21,27,30,34-35H,4,7-12,15-16H2,1H3/t17-,18?,19?,27-,30-/m1/s1 |
| InChIKey | CMRHXWNGTZLVNV-BMEMXDEESA-N |
| XLogP | 6.04 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|