C30H36FN3O — CID 167141463
(1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 167141463) has the molecular formula C30H36FN3O and a molecular weight of 473.64 g/mol. Its IUPAC name is (1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 167141463 |
| Molecular Formula | C30H36FN3O |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (1R,3R)-2-[(2R)-2-bicyclo[2.1.1]hexanyl]-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OC3CN(CCCF)C3)cc2)N1[C@@H]1CC2CC1C2 |
| InChI | InChI=1S/C30H36FN3O/c1-19-13-26-25-5-2-3-6-27(25)32-29(26)30(34(19)28-16-20-14-22(28)15-20)21-7-9-23(10-8-21)35-24-17-33(18-24)12-4-11-31/h2-3,5-10,19-20,22,24,28,30,32H,4,11-18H2,1H3/t19-,20?,22?,28-,30-/m1/s1 |
| InChIKey | CIBBKCQFIPURQQ-CZZJQDJCSA-N |
| XLogP | 5.72 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|