C27H28F7N3O2 — CID 164855396
(1R,3R)-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-(trifluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164855396) has the molecular formula C27H28F7N3O2 and a molecular weight of 559.53 g/mol. Its IUPAC name is (1R,3R)-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-(trifluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-(trifluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164855396 |
| Molecular Formula | C27H28F7N3O2 |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | (1R,3R)-1-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-(trifluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OC3CN(CCCF)C3)cc2OC(F)(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C27H28F7N3O2/c1-16-11-21-19-5-2-3-6-22(19)35-24(21)25(37(16)15-26(29,30)31)20-8-7-17(12-23(20)39-27(32,33)34)38-18-13-36(14-18)10-4-9-28/h2-3,5-8,12,16,18,25,35H,4,9-11,13-15H2,1H3/t16-,25-/m1/s1 |
| InChIKey | JRBKNANGWMWMCG-PUAOIOHZSA-N |
| XLogP | 6.39 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|