C29H34F6N4O — CID 167202836
N-[3-(difluoromethoxy)-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)piperidin-4-amine (PubChem CID 167202836) has the molecular formula C29H34F6N4O and a molecular weight of 568.61 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)piperidin-4-amine.
| Compound Name | N-[3-(difluoromethoxy)-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 167202836 |
| Molecular Formula | C29H34F6N4O |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)piperidin-4-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(NC3CCN(CCCF)CC3)cc2OC(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C29H34F6N4O/c1-18-15-23-21-5-2-3-6-24(21)37-26(23)27(39(18)17-29(33,34)35)22-8-7-20(16-25(22)40-28(31)32)36-19-9-13-38(14-10-19)12-4-11-30/h2-3,5-8,16,18-19,27-28,36-37H,4,9-15,17H2,1H3/t18-,27-/m1/s1 |
| InChIKey | BDNQAKFFYZENNF-DNOBIOAJSA-N |
| XLogP | 6.90 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|