C26H30F5N5 — CID 166473174
6-[(1S,3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine (PubChem CID 166473174) has the molecular formula C26H30F5N5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 6-[(1S,3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(1S,3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 166473174 |
| Molecular Formula | C26H30F5N5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 6-[(1S,3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccc(F)cc23)[C@@H](c2ccc(N[C@H]3CCN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C26H30F5N5/c1-16-11-21-20-12-17(28)3-5-22(20)34-24(21)25(36(16)15-26(29,30)31)23-6-4-18(13-32-23)33-19-7-10-35(14-19)9-2-8-27/h3-6,12-13,16,19,25,33-34H,2,7-11,14-15H2,1H3/t16-,19+,25-/m1/s1 |
| InChIKey | PJBFENRSHRYDDD-IYJATWDHSA-N |
| XLogP | 5.45 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|